Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | (2,4,5-trichlorophenoxy)acetic acid—2,2′,2″-nitrilotri(ethan-1-ol) (1/1) |
IUPAC name: | (2,4,5-trichlorophenoxy)acetic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium (2,4,5-trichlorophenoxy)acetate |
CAS name: | 2-(2,4,5-trichlorophenoxy)acetic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
CAS Reg. No.: | 3813-14-7 |
Formula: | C14H20Cl3NO6 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4,5-T [93-76-5]. |
Structure: | |
Pronunciation: | too for fīv tē trǒl-a-mēn Guide to British pronunciation |
InChIKey: | VTZDSNBPOOWJST-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H5Cl3O3.C6H15NO3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;8-4-1-7(2-5-9)3-6-10/h1-2H,3H2,(H,12,13);8-10H,1-6H2 |
A data sheet from the Compendium of Pesticide Common Names