| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2,4,5-trichlorophenoxy)acetic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium (2,4,5-trichlorophenoxy)acetate |
| CAS: | (2,4,5-trichlorophenoxy)acetic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
| Reg. No.: | 3813-14-7 |
| Formula: | C14H20Cl3NO6 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4,5-T [93-76-5]. |
| Structure: | ![]() |
| Pronunciation: | too for fīv tē trǒl-a-mēn Guide to British pronunciation |
| InChI: | InChI=1/C8H5Cl3O3.C6H15NO3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;8-4-1-7(2-5-9)3-6-10/h1-2H,3H2,(H,12,13);8-10H,1-6H2/f/h12H; |
A data sheet from the Compendium of Pesticide Common Names