| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2,4,5-trichlorophenoxy)acetic acid - triethylamine (1:1) or triethylammonium (2,4,5-trichlorophenoxy)acetate |
| CAS: | 2-(2,4,5-trichlorophenoxy)acetic acid compound with N,N-diethylethanamine (1:1) |
| Reg. No.: | 2008-46-0 |
| Formula: | C14H20Cl3NO3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4,5-T [93-76-5]. |
| Structure: | ![]() |
| Pronunciation: | too for fīv tē trī-ē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | QZKXBNCXPQMZLF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H5Cl3O3.C6H15N/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;1-4-7(5-2)6-3/h1-2H,3H2,(H,12,13);4-6H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names