| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium (2,4,5-trichlorophenoxy)acetate |
| CAS: | sodium (2,4,5-trichlorophenoxy)acetate |
| Reg. No.: | 13560-99-1 |
| Formula: | C8H4Cl3NaO2 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4,5-T [93-76-5]. |
| Structure: | ![]() |
| Pronunciation: | too for fīv tē sō-dē-am Guide to British pronunciation |
| InChI: | InChI=1/C8H5Cl3O3.Na/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;/h1-2H,3H2,(H,12,13);/q;+1/p-1/fC8H4Cl3O3.Na/q-1;m |
A data sheet from the Compendium of Pesticide Common Names