| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 2-butoxyethyl (2,4,5-trichlorophenoxy)acetate |
| CAS: | 2-butoxyethyl 2-(2,4,5-trichlorophenoxy)acetate |
| Reg. No.: | 2545-59-7 |
| Formula: | C14H17Cl3O4 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4,5-T [93-76-5]. |
| Structure: | ![]() |
| Pronunciation: | too for fīv tē bū-tō-tīl Guide to British pronunciation |
| InChIKey: | GLDWASBMYWLQGG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H17Cl3O4/c1-2-3-4-19-5-6-20-14(18)9-21-13-8-11(16)10(15)7-12(13)17/h7-8H,2-6,9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names