| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-butoxypropyl (2,4,5-trichlorophenoxy)acetate |
| CAS: | 2-butoxypropyl 2-(2,4,5-trichlorophenoxy)acetate |
| Reg. No.: | 3084-62-6 |
| Formula: | C15H19Cl3O4 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4,5-T [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for fīv tē too bū-tǒks-ē-prō-pīl Guide to British pronunciation |
| InChIKey: | OFYUBGDUYQVZHD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H19Cl3O4/c1-3-4-5-20-10(2)8-22-15(19)9-21-14-7-12(17)11(16)6-13(14)18/h6-7,10H,3-5,8-9H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names