| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 2,3,6-trichlorobenzoate |
| CAS: | sodium 2,3,6-trichlorobenzoate |
| Reg. No.: | 2078-42-4 |
| Formula: | C7H2Cl3NaO2 |
| Activity: | herbicides (benzoic acid herbicides) |
| Notes: | This substance is a derivative of 2,3,6-TBA [50-31-7]. The name “TCBA-sodium” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | too thrē sǐks tē bē ā sō-dē-am Guide to British pronunciation |
| InChI: | InChI=1/C7H3Cl3O2.Na/c8-3-1-2-4(9)6(10)5(3)7(11)12;/h1-2H,(H,11,12);/q;+1/p-1/fC7H2Cl3O2.Na/q-1;m |