| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 2,3,6-trichlorobenzoic acid - dimethylamine (1:1) or dimethylammonium 2,3,6-trichlorobenzoate |
| CAS: | 2,3,6-trichlorobenzoic acid compound with N-methylmethanamine (1:1) |
| Reg. No.: | 3426-62-8 |
| Formula: | C9H10Cl3NO2 |
| Activity: | herbicides (benzoic acid herbicides) |
| Notes: | This substance is a derivative of 2,3,6-TBA [50-31-7]. The name “TCBA-dimethylammonium” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | too thrē sǐks tē bē ā dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C7H3Cl3O2.C2H7N/c8-3-1-2-4(9)6(10)5(3)7(11)12;1-3-2/h1-2H,(H,11,12);3H,1-2H3/f/h11H; |