| Status: | none |
|---|---|
| IUPAC: | 2-acetyl-5-methyl-3-oxopent-4-en-5-olide or 3-acetyl-6-methylpyran-2,4-dione |
| CAS: | 3-acetyl-2-hydroxy-6-methyl-4H-pyran-4-one also 3-acetyl-4-hydroxy-6-methyl-2H-pyran-2-one also 3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione |
| Reg. No.: | 16807-48-0; 771-03-9; 520-45-6 |
| Formula: | C8H8O4 |
| Activity: | fungicides (unclassified fungicides) |
| Notes: | There is no ISO common name for this substance; the name “dehydroacetic acid” has been used in the literature but has no official status. Exists in three tautomeric forms. |
| Structure: | ![]() |
| Pronunciation: | dē-hī-drō-a-sē-tǐk ǎs-ǐd Guide to British pronunciation |
| InChI: | 3-acetyl-2-hydroxy-6-methyl-4H-pyran-4-one: InChI=1/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,11H,1-2H3 3-acetyl-4-hydroxy-6-methyl-2H-pyran-2-one: InChI=1/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,10H,1-2H3 3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione: InChI=1/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,7H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names