| Status: | JMAFF |
|---|---|
| IUPAC: | bis(2-chloro-1-methylethyl) ether |
| CAS: | 2,2′-oxybis[1-chloropropane] |
| Reg. No.: | 108-60-1 |
| Formula: | C6H12Cl2O |
| Activity: | nematicides (unclassified nematicides) |
| Notes: | There is no ISO common name for this substance; the name “DCIP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| Pronunciation: | dē sē ī pē Guide to British pronunciation |
| InChI: | InChI=1/C6H12Cl2O/c1-5(3-7)9-6(2)4-8/h5-6H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names