| Status: | JMAFF |
|---|---|
| IUPAC: | (RS)-1,2-dibromo-3-chloropropane |
| CAS: | 1,2-dibromo-3-chloropropane |
| Reg. No.: | 96-12-8 |
| Formula: | C3H5Br2Cl |
| Activity: | fungicides (unclassified fungicides) nematicides (unclassified nematicides) |
| Notes: | There is no ISO common name for this substance; the name “DBCP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| InChI: | InChI=1/C3H5Br2Cl/c4-1-3(5)2-6/h3H,1-2H2/t3-/s3 |
A data sheet from the Compendium of Pesticide Common Names