| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3,5-dimethyl-1,3,5-thiadiazinane-2-thione or tetrahydro-3,5-dimethyl-1,3,5-thiadiazine-2-thione |
| CAS: | tetrahydro-3,5-dimethyl-2H-1,3,5-thiadiazine-2-thione |
| Reg. No.: | 533-74-4 |
| Formula: | C5H10N2S2 |
| Activity: | fungicides (cyclic dithiocarbamate fungicides) herbicides (dithiocarbamate herbicides) nematicides (unclassified nematicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example dazomet-sodium [53404-60-7]. The name “thiazone” (тиазон) was used in the former USSR. |
| Pronunciation: | dǎz-ō-mět Guide to British pronunciation |
| Structure: | ![]() |
| InChIKey: | QAYICIQNSGETAS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C5H10N2S2/c1-6-3-7(2)5(8)9-4-6/h3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names