| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1-methyl-4-phenylpyridinium |
| CAS: | 1-methyl-4-phenylpyridinium |
| Reg. No.: | 48134-75-4 |
| Formula: | C12H12N |
| Activity: | herbicides (quaternary ammonium herbicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example cyperquat chloride. |
| Structure: | ![]() |
| Pronunciation: | sī-per-kwǒt Guide to British pronunciation |
| InChIKey: | FMGYKKMPNATWHP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H12N/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3/q+1 |
A data sheet from the Compendium of Pesticide Common Names