Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 1-methyl-4-phenylpyridin-1-ium |
IUPAC name: | 1-methyl-4-phenylpyridinium |
CAS name: | 1-methyl-4-phenylpyridinium |
CAS Reg. No.: | 48134-75-4 |
Formula: | C12H12N |
Activity: | herbicides (quaternary ammonium) |
Notes: | When this substance is used as a salt, its identity should be stated, for example cyperquat chloride [39794-99-5]. |
Structure: | |
Pronunciation: | sī-per-kwǒt Guide to British pronunciation |
InChIKey: | FMGYKKMPNATWHP-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H12N/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3/q+1 |
A data sheet from the Compendium of Pesticide Common Names