| Status: | none |
|---|---|
| IUPAC: | N-[(2EZ)-3-methyl-1,3-thiazol-2(3H)-ylidene]-2,4-xylidine |
| CAS: | 2,4-dimethyl-N-(3-methyl-2(3H)-thiazolylidene)benzenamine |
| Reg. No.: | 61676-87-7 |
| Formula: | C12H14N2S |
| Activity: | acaricides (unclassified acaricides) |
| Notes: | There is no ISO common name for this substance; the names “cymiazole” and “xymiazole” have been used in the literature but they have no official status. The name “tifatol” (螨蜱胺) is approved in China, even though Tifatol is (or was) a registered trade mark in many countries. When this substance is used as a salt, its identity should be stated, for example cymiazole hydrochloride [121034-85-3]. |
| Structure: | ![]() |
| Pronunciation: | sī-mē-a-zōl Guide to British pronunciation |
| InChIKey: | YUAUPYJCVKNAEC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H14N2S/c1-9-4-5-11(10(2)8-9)13-12-14(3)6-7-15-12/h4-8H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names