| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propionic acid |
| CAS: | (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid |
| Reg. No.: | 122008-78-0 |
| Formula: | C16H12FNO4 |
| Activity: | herbicides (aryloxyphenoxypropionic herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example cyhalofop-butyl [122008-85-9]. |
| Structure: | ![]() |
| Pronunciation: | sī-hǎl-ō-fǒp Guide to British pronunciation |
| InChIKey: | ROBSGBGTWRRYSK-SNVBAGLBSA-N |
| InChI: | InChI=1S/C16H12FNO4/c1-10(16(19)20)21-12-3-5-13(6-4-12)22-15-7-2-11(9-18)8-14(15)17/h2-8,10H,1H3,(H,19,20)/t10-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names