Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | (Ξ)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1Ξ,3Ξ)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
IUPAC name: | (RS)-α-cyano-4-fluoro-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
CAS name: | cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
CAS Reg. No.: | 68359-37-5 |
Formula: | C22H18Cl2FNO3 |
Activity: | insecticides (pyrethroid) |
Notes: | One subset of isomers of this substance has its own ISO common name; see beta-cyfluthrin [1820573-27-0]. |
Structure: | |
Pronunciation: | sī-floo-thrǐn Guide to British pronunciation |
InChIKey: | QQODLKZGRKWIFG-UHFFFAOYSA-N |
InChI: | InChI=1S/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names