| Status: | BSI |
|---|---|
| IUPAC: | tricopper dichloride dimethyldithiocarbamate |
| CAS: | dichloro(dimethylcarbamodithioato)tricopper |
| Reg. No.: | 7076-63-3 |
| Formula: | C3H6Cl2Cu3NS2 |
| Activity: | fungicides (copper fungicides; dithiocarbamate fungicides) |
| Notes: | There is no ISO common name for this substance; the name “cuprobam” is approved by the British Standards Institution. |
| Structure: | |
| Pronunciation: | kū-prō-bǎm Guide to British pronunciation |
| InChI: | InChI=1/C3H7NS2.2ClH.3Cu/c1-4(2)3(5)6;;;;;/h1-2H3,(H,5,6);2*1H;;;/q;;;3*+1/p-3/fC3H6NS2.2Cl.3Cu/h;2*1h;;;/q3*-1;3m |
A data sheet from the Compendium of Pesticide Common Names