| Status: | ISO 765 |
|---|---|
| IUPAC: | cresol |
| CAS: | methylphenol |
| Reg. No.: | 1319-77-3 |
| Formula: | C7H8O |
| Activity: | bactericides fungicides (aromatic fungicides) herbicides (unclassified herbicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name; “cresylic acid” is given as an alternative. |
| Structure: |  |
| Pronunciation: | krē-sǒl Guide to British pronunciation |
| InChI: | o-cresol InChI=1/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3 m-cresol InChI=1/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 p-cresol InChI=1/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3 |