Status: | JMAFF |
---|---|
IUPAC PIN: | 3-(2-methylphenoxy)pyridazine |
IUPAC name: | pyridazin-3-yl o-tolyl ether |
CAS name: | 3-(2-methylphenoxy)pyridazine |
CAS Reg. No.: | 14491-59-9 |
Formula: | C11H10N2O |
Activity: | herbicides (pyridazine) |
Notes: | There is no ISO common name for this substance; the name “credazine” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (醚草敏). |
Structure: | |
Pronunciation: | krē-da-zēn Guide to British pronunciation |
InChIKey: | DNPSYFHJYIRREW-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H10N2O/c1-9-5-2-3-6-10(9)14-11-7-4-8-12-13-11/h2-8H,1H3 |
A data sheet from the Compendium of Pesticide Common Names