Status: | WSSA |
---|---|
IUPAC PIN: | rac-(2R)-1-chloropropan-2-yl (3-chlorophenyl)carbamate |
IUPAC name: | (2RS)-1-chloropropan-2-yl (3-chlorophenyl)carbamate 1979 Rules: (RS)-2-chloro-1-methylethyl 3-chlorocarbanilate |
CAS name: | 2-chloro-1-methylethyl N-(3-chlorophenyl)carbamate |
CAS Reg. No.: | 2150-32-5 |
Formula: | C10H11Cl2NO2 |
Activity: | herbicides (carbamate) |
Notes: | There is no ISO common name for this substance; the name “CPPC” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | sē pē pē sē Guide to British pronunciation |
InChIKey: | WLKSPGHQGFFKGE-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H11Cl2NO2/c1-7(6-11)15-10(14)13-9-4-2-3-8(12)5-9/h2-5,7H,6H2,1H3,(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names