| Status: | WSSA |
|---|---|
| IUPAC: | (EZ)-1-chloro-N2-(3,4-dichlorophenyl)-N1,N1-dimethylformamidine |
| CAS: | 1-chloro-N′-(3,4-dichlorophenyl)-N,N-dimethylmethanimidamide |
| Reg. No.: | 6022-33-9 |
| Formula: | C9H9Cl3N2 |
| Activity: | herbicides (unclassified herbicides) |
| Notes: | There is no ISO common name for this substance; the name “CPMF” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | sē pē ěm ěf Guide to British pronunciation |
| InChIKey: | WKQYAIDXQNGNIQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9Cl3N2/c1-14(2)9(12)13-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names