| Status: | JMAFF |
|---|---|
| IUPAC: | 2-chlorophenyl methylcarbamate |
| CAS: | 2-chlorophenyl N-methylcarbamate |
| Reg. No.: | 3942-54-9 |
| Formula: | C8H8ClNO2 |
| Activity: | insecticides (phenyl methylcarbamate insecticides) |
| Notes: | There is no ISO common name for this substance; the name “CPMC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (害扑威). |
| Structure: | ![]() |
| Pronunciation: | sē pē ěm sē Guide to British pronunciation |
| InChIKey: | ZAGNMMRDHSEOPE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H8ClNO2/c1-10-8(11)12-7-5-3-2-4-6(7)9/h2-5H,1H3,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names