| Status: | ISO 765 |
|---|---|
| IUPAC: | |
| CAS: | [μ-[carbonato(2−)-κO:κO′]]dihydroxydicopper |
| Reg. No.: | 12069-69-1 |
| Formula: | CH2Cu2O5 |
| Activity: | fungicides (copper fungicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | kǒp-a car-ba-nāt bā-sǐk Guide to British pronunciation |
| InChIKey: | ZMMDPCMYTCRWFF-UHFFFAOYSA-J |
| InChI: | InChI=1S/CH2O3.2Cu.2H2O/c2-1(3)4;;;;/h(H2,2,3,4);;;2*1H2/q;2*+2;;/p-4 |
A data sheet from the Compendium of Pesticide Common Names