| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC: | 4-chloro-α-hydroxy-o-tolyloxyacetic acid |
| CAS: | [4-chloro-2-(hydroxymethyl)phenoxy]acetic acid |
| Reg. No.: | 6386-63-6 |
| Formula: | C9H9ClO4 |
| Activity: | plant growth regulators (unclassified plant growth regulators) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example cloxyfonac-sodium [32791-87-0]. |
| Structure: | ![]() |
| InChI: | InChI=1/C9H9ClO4/c10-7-1-2-8(6(3-7)4-11)14-5-9(12)13/h1-3,11H,4-5H2,(H,12,13)/f/h12H |
A data sheet from the Compendium of Pesticide Common Names