| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (5-chloroquinolin-8-yloxy)acetic acid |
| CAS: | [(5-chloro-8-quinolinyl)oxy]acetic acid |
| Reg. No.: | 88349-88-6 |
| Formula: | C11H8ClNO3 |
| Activity: | herbicide safeners |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example cloquintocet-mexyl [99607-70-2]. |
| Structure: | ![]() |
| Pronunciation: | klō-kwǐn-tō-sět Guide to British pronunciation |
| InChIKey: | ICJSJAJWTWPSBD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H8ClNO3/c12-8-3-4-9(16-6-10(14)15)11-7(8)2-1-5-13-11/h1-5H,6H2,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names