Approval: | ISO |
---|---|
IUPAC PIN: | [(5-chloro-8-quinolinyl)oxy]acetic acid |
IUPAC name: | [(5-chloro-8-quinolyl)oxy]acetic acid |
CAS name: | 2-[(5-chloro-8-quinolinyl)oxy]acetic acid |
CAS Reg. No.: | 88349-88-6 |
Formula: | C11H8ClNO3 |
Activity: | herbicide safeners |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example cloquintocet-methyl [4367-49-1], cloquintocet-mexyl [99607-70-2]. |
Structure: | |
Pronunciation: | klō-kwǐn-tō-sět Guide to British pronunciation |
InChIKey: | ICJSJAJWTWPSBD-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H8ClNO3/c12-8-3-4-9(16-6-10(14)15)11-7(8)2-1-5-13-11/h1-5H,6H2,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names