
Chinese: 调果酸French: cloprop (n.m.)Russian: клопроп

Status: ISO 1750 (published)
IUPAC PIN: rac-(2R)-2-(3-chlorophenoxy)propanoic acid
IUPAC name: (2RS)-2-(3-chlorophenoxy)propanoic acid
1979 Rules:
(RS)-2-(3-chlorophenoxy)propionic acid
CAS name: 2-(3-chlorophenoxy)propanoic acid
CAS Reg. No.: 101-10-0
Formula: C9H9ClO3
Activity: herbicides (phenoxypropionic herbicides)
Structure: Structural formula of cloprop
Pronunciation: klō-prǒp  Guide to British pronunciation
InChI: InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12)

A data sheet from the Compendium of Pesticide Common Names