| Status: |
ISO 1750 (published) |
| IUPAC: |
2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxopyridazine-4-carboxylic acid |
| CAS: |
2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylic acid |
| Reg. No.: |
129025-54-3 |
| Formula: |
C13H11ClN2O3 |
| Activity: |
plant growth regulators (unclassified plant growth regulators) |
| Notes: |
When this substance is used as an ester or a salt, its identity should be stated, for example clofencet-potassium [82697-71-0]. |
| Structure: |
 |
| Pronunciation: |
klō-fěn-sět Guide to British pronunciation |
| InChI: |
InChI=1/C13H11ClN2O3/c1-2-10-12(13(18)19)11(17)7-15-16(10)9-5-3-8(14)4-6-9/h3-7H,2H2,1H3,(H,18,19)/f/h18H |