Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | (2R)-2-{4-[(5-chloro-3-fluoropyridin-2-yl)oxy]phenoxy}propanoic acid |
IUPAC name: | (2R)-2-{4-[(5-chloro-3-fluoro-2-pyridyl)oxy]phenoxy}propanoic acid 1979 Rules: (R)-2-{4-[(5-chloro-3-fluoro-2-pyridyl)oxy]phenoxy}propionic acid |
CAS name: | (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid |
CAS Reg. No.: | 114420-56-3 |
Formula: | C14H11ClFNO4 |
Activity: | herbicides (aryloxyphenoxypropionic) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example clodinafop-propargyl [105512-06-9]. |
Structure: | |
Pronunciation: | klō-dīn-a-fǒp Guide to British pronunciation |
InChIKey: | YUIKUTLBPMDDNQ-MRVPVSSYSA-N |
InChI: | InChI=1S/C14H11ClFNO4/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13/h2-8H,1H3,(H,18,19)/t8-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names