| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (R)-2-[4-(5-chloro-3-fluoro-2-pyridyloxy)phenoxy]propionic acid |
| CAS: | (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid |
| Reg. No.: | 114420-56-3 |
| Formula: | C14H11ClFNO4 |
| Activity: | herbicides (aryloxyphenoxypropionic herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example clodinafop-propargyl [105512-06-9]. |
| Structure: | ![]() |
| Pronunciation: | klō-dīn-a-fǒp Guide to British pronunciation |
| InChI: | InChI=1/C14H11ClFNO4/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13/h2-8H,1H3,(H,18,19)/t8-/m1/s1/f/h18H |
A data sheet from the Compendium of Pesticide Common Names