| Status: |
ISO 1750 (published) |
| IUPAC: |
(5RS)-2-{(1EZ)-1-[(2E)-3-chloroallyloxyimino]propyl}-5-[(2RS)-2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-one |
| CAS: |
2-[1-[[[(2E)-3-chloro-2-propen-1-yl]oxy]imino]propyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one |
| Reg. No.: |
99129-21-2 |
| Formula: |
C17H26ClNO3S |
| Activity: |
herbicides (cyclohexene oxime herbicides) |
| Notes: |
The name clethodim was originally approved for the substance with (E)-stereochemistry at the C=N double bond, but in 2008 the manufacturer determined that the (Z)-isomer is also present in the manufactured product and requested that the definition be changed. |
| Structure: |
 |
| Pronunciation: |
clěth-ō-dǐm Guide to British pronunciation |
| InChIKey: |
SILSDTWXNBZOGF-JWGBMQLESA-N |
| InChI: |
InChI=1S/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,20H,4-5,8-11H2,1-3H3/b7-6+,19-14? |