| Status: | ANSI |
|---|---|
| IUPAC: | cis-2,5-dimethylpyrrolidine-1-carboxanilide |
| CAS: | (2R,5S)-rel-2,5-dimethyl-N-phenyl-1-pyrrolidinecarboxamide |
| Reg. No.: | 34484-77-0 |
| Formula: | C13H18N2O |
| Activity: | herbicides (anilide herbicides) |
| Notes: | There is no ISO common name for this substance; the name “cisanilide” is approved by the American National Standards Institute and the Weed Science Society of America. |
| Structure: | ![]() |
| InChI: | InChI=1/C13H18N2O/c1-10-8-9-11(2)15(10)13(16)14-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3,(H,14,16)/t10-,11+/f/h14H |
A data sheet from the Compendium of Pesticide Common Names