
French: chloroxynil (n.m.)Russian: хлороксинил

Status: ISO 1750 (published)
IUPAC PIN: 3,5-dichloro-4-hydroxybenzonitrile
IUPAC name: 3,5-dichloro-4-hydroxybenzonitrile
CAS name: 3,5-dichloro-4-hydroxybenzonitrile
CAS Reg. No.: 1891-95-8
Formula: C7H3Cl2NO
Activity: herbicides (nitrile herbicides)
Structure: Structural formula of chloroxynil
Pronunciation: klor-ǒks-ǐ-nǐl  Guide to British pronunciation
InChI: InChI=1S/C7H3Cl2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H

A data sheet from the Compendium of Pesticide Common Names