| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-chloro-3-(4-chlorophenyl)propionic acid |
| CAS: | α,4-dichlorobenzenepropanoic acid |
| Reg. No.: | 59604-11-4 |
| Formula: | C9H8Cl2O2 |
| Activity: | herbicides (unclassified herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example chlorfenprop-methyl [14437-17-3]. The name “chlorfenprop-methyl” was formerly approved by ISO for the methyl ester, but this was replaced by the name “chlorfenprop” for the acid as part of a rationalisation exercise in 1989. |
| Structure: |  |
| Pronunciation: | klor-fěn-prǒp Guide to British pronunciation |
| InChI: | InChI=1/C9H8Cl2O2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5H2,(H,12,13)/f/h12H |