| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (2,3,6-trichlorophenyl)acetic acid |
| CAS: | 2,3,6-trichlorobenzeneacetic acid |
| Reg. No.: | 85-34-7 |
| Formula: | C8H5Cl3O2 |
| Activity: | herbicides (unclassified herbicides) |
| Notes: | The name “fenac” is used in Canada and the USA. When this substance is used as an ester or a salt, its identity should be stated, for example chlorfenac-sodium [2439-00-1]. |
| Structure: | ![]() |
| Pronunciation: | klor-fěn-ǎk Guide to British pronunciation |
| InChI: | InChI=1/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13)/f/h12H |
A data sheet from the Compendium of Pesticide Common Names