| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (EZ)-N2-(4-chloro-o-tolyl)-N1,N1-dimethylformamidine |
| CAS: | N′-(4-chloro-2-methylphenyl)-N,N-dimethylmethanimidamide |
| Reg. No.: | 6164-98-3 |
| Formula: | C10H13ClN2 |
| Activity: | acaricides (formamidine acaricides) antifeedants insecticides (formamidine insecticides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example chlordimeform hydrochloride [19750-95-9]. |
| Structure: | ![]() |
| Pronunciation: | klor-dī-mē-form Guide to British pronunciation |
| InChIKey: | STUSTWKEFDQFFZ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H13ClN2/c1-8-6-9(11)4-5-10(8)12-7-13(2)3/h4-7H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names