| Status: | BSI |
|---|---|
| IUPAC: | 6-chloro-N2,N2,N4,N4-tetraethyl-1,3,5-triazine-2,4-diamine |
| CAS: | 6-chloro-N,N,N′,N′-tetraethyl-1,3,5-triazine-2,4-diamine |
| Reg. No.: | 580-48-3 |
| Formula: | C11H20ClN5 |
| Activity: | herbicides (chlorotriazine herbicides) |
| Notes: | There is no ISO common name for this substance; the name “chlorazine” is approved by the British Standards Institution and the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | klor-a-zēn Guide to British pronunciation |
| InChIKey: | QHXDTLYEHWXDSO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H20ClN5/c1-5-16(6-2)10-13-9(12)14-11(15-10)17(7-3)8-4/h5-8H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names