arylaminopropionic acid_herbicides
Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-(2R)-2-{4-[(3,5-dichloropyridin-2-yl)oxy]phenoxy}propanoic acid |
IUPAC name: | (2RS)-2-{4-[(3,5-dichloro-2-pyridyl)oxy]phenoxy}propanoic acid 1979 Rules: (RS)-2-{4-[(3,5-dichloro-2-pyridyl)oxy]phenoxy}propionic acid |
CAS name: | 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid |
CAS Reg. No.: | 60074-25-1 |
Formula: | C14H11Cl2NO4 |
Activity: | herbicides (aryloxyphenoxypropionic) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example chlorazifop-propargyl [72880-52-5]. |
Structure: | |
Pronunciation: | klor-ǎz-ǐ-fǒp Guide to British pronunciation |
InChIKey: | SVGBNTOHFITEDI-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H11Cl2NO4/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13/h2-8H,1H3,(H,18,19) |
A data sheet from the Compendium of Pesticide Common Names