| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-[4-(3,5-dichloro-2-pyridyloxy)phenoxy]propionic acid |
| CAS: | 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoic acid |
| Reg. No.: | 60074-25-1 |
| Formula: | C14H11Cl2NO4 |
| Activity: | herbicides (aryloxyphenoxypropionic herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example chlorazifop-propargyl [72880-52-5]. |
| Structure: | ![]() |
| Pronunciation: | klor-ǎz-ǐ-fǒp Guide to British pronunciation |
| InChIKey: | SVGBNTOHFITEDI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H11Cl2NO4/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13/h2-8H,1H3,(H,18,19) |
A data sheet from the Compendium of Pesticide Common Names