| Status: | ISO 765 |
|---|---|
| IUPAC: | tetrachloro-p-benzoquinone |
| CAS: | 2,3,5,6-tetrachloro-2,5-cyclohexadiene-1,4-dione |
| Reg. No.: | 118-75-2 |
| Formula: | C6Cl4O2 |
| Activity: | fungicides (quinone fungicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | klor-a-nǐl Guide to British pronunciation |
| InChI: | InChI=1/C6Cl4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
A data sheet from the Compendium of Pesticide Common Names