| Status: | none |
|---|---|
| IUPAC: | mixture of copper sulfate and diammonium carbonate |
| CAS: | diammonium carbonate mixture with copper(2+) sulfate (1:1) |
| Reg. No.: | 55632-67-2 |
| Formula: | |
| Activity: | fungicides (copper fungicides) |
| Notes: | There is no ISO common name for this substance; the name “Cheshunt mixture” has been used in the literature but has no official status. |
| Structure: |  |
| Pronunciation: | chěsh-ant mǐkst-sha Guide to British pronunciation |
| InChI: | copper(2+) sulfate (1:1) InChI=1/Cu.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2/fCu.O4S/qm;-2 diammonium carbonate InChI=1/CH2O3.2H3N/c2-1(3)4;;/h(H2,2,3,4);2*1H3/fCO3.2H4N/h;2*1H/q-2;2*+1 |