| Status: | none |
|---|---|
| IUPAC: | ethyl (±)-4(or 5)-iodo-2-methylcyclohexanecarboxylate |
| CAS: | ethyl 4(or 5)-iodo-2-methyl-1-cyclohexanecarboxylate |
| Reg. No.: | 160016-46-6 |
| Formula: | C10H17IO2 |
| Activity: | insect attractants (dipteran attractants) |
| Notes: | There is no ISO common name for this substance; the name “ceralure” has been used in the literature but has no official status. This substance is named after the insect that it is used to attract, the Mediterranean fruit fly Ceratitis capitata (Wiedemann) (Tephritidae, Diptera). |
| Structure: |  |
| Pronunciation: | sěr-a-lūr Guide to British pronunciation |
| InChI: | 4-iodo isomer: InChI=1/C10H17IO2/c1-3-13-10(12)9-5-4-8(11)6-7(9)2/h7-9H,3-6H2,1-2H3 5-iodo isomer: InChI=1/C10H17IO2/c1-3-13-10(12)9-6-8(11)5-4-7(9)2/h7-9H,3-6H2,1-2H3 |