Status: | WSSA |
---|---|
IUPAC PIN: | 2-chloroethyl (3-chlorophenyl)carbamate |
IUPAC name: | 2-chloroethyl (3-chlorophenyl)carbamate 1979 Rules: 2-chloroethyl 3-chlorocarbanilate |
CAS name: | 2-chloroethyl N-(3-chlorophenyl)carbamate |
CAS Reg. No.: | 587-56-4 |
Formula: | C9H9Cl2NO2 |
Activity: | herbicides (carbamate) |
Notes: | There is no ISO common name for this substance; the name “CEPC” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | sē ē pē sē Guide to British pronunciation |
InChIKey: | GYJQWEIGUGMFMU-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H9Cl2NO2/c10-4-5-14-9(13)12-8-3-1-2-7(11)6-8/h1-3,6H,4-5H2,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names