| Status: | China |
|---|---|
| IUPAC: | 5-isopropyl-2-methylphenol |
| CAS: | 2-methyl-5-(1-methylethyl)phenol |
| Reg. No.: | 499-75-2 |
| Formula: | C10H14O |
| Activity: | acaricides (botanical acaricides) fungicides (botanical fungicides) insecticides (botanical insecticides) nematicides (botanical nematicides) |
| Notes: | There is no ISO common name for this substance; the trivial name “carvacrol” (香芹酚) is approved as a common name in China. |
| Structure: |  |
| Pronunciation: | kar-va-krǒl Guide to British pronunciation |
| InChIKey: | RECUKUPTGUEGMW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |