Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | S,S′-[2-(dimethylamino)propane-1,3-diyl] dicarbamothioate |
IUPAC name: | S,S′-[2-(dimethylamino)trimethylene] bis(thiocarbamate) |
CAS name: | S,S′-[2-(dimethylamino)-1,3-propanediyl] dicarbamothioate |
CAS Reg. No.: | 15263-53-3 |
Formula: | C7H15N3O2S2 |
Activity: | insecticides (nereistoxin analogue) |
Notes: | When this substance is used as a salt, its identity should be stated, for example cartap hydrochloride [15263-52-2]. |
Structure: | |
Pronunciation: | kar-tǎp Guide to British pronunciation |
InChIKey: | IRUJZVNXZWPBMU-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H15N3O2S2/c1-10(2)5(3-13-6(8)11)4-14-7(9)12/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12) |
A data sheet from the Compendium of Pesticide Common Names