Status: | USSR |
---|---|
IUPAC PIN: | di(azepan-1-yl)methanone |
IUPAC name: | di(azepan-1-yl) ketone 1979 Rules: bis(perhydroazepin-1-yl) ketone |
CAS name: | bis(hexahydro-1H-azepin-1-yl)methanone |
CAS Reg. No.: | 25991-86-0 |
Formula: | C13H24N2O |
Activity: | insect repellents |
Notes: | There is no ISO common name for this substance; the name “carboxide” (карбоксид) was used in the former USSR. In some countries, “Carboxide” is a trade name for a fumigant containing a mixture of ethylene oxide and carbon dioxide. |
Structure: | |
Pronunciation: | kar-bǒk-sīd Guide to British pronunciation |
InChIKey: | BZDSNHCMPJUKOY-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H24N2O/c16-13(14-9-5-1-2-6-10-14)15-11-7-3-4-8-12-15/h1-12H2 |
A data sheet from the Compendium of Pesticide Common Names