| Status: | USSR |
|---|---|
| IUPAC: | bis(perhydroazepin-1-yl) ketone or bis(azepan-1-yl) ketone |
| CAS: | 1,1′-carbonylbis[hexahydro-1H-azepine] |
| Reg. No.: | 25991-86-0 |
| Formula: | C13H24N2O |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “carboxide” (карбоксид) was used in the former USSR. In some countries, “Carboxide” is a trade name for a fumigant containing a mixture of ethylene oxide and carbon dioxide. |
| Structure: |  |
| InChI: | InChI=1/C13H24N2O/c16-13(14-9-5-1-2-6-10-14)15-11-7-3-4-8-12-15/h1-12H2 |