| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1-naphthyl methylcarbamate |
| CAS: | 1-naphthalenyl methylcarbamate |
| Reg. No.: | 63-25-2 |
| Formula: | C12H11NO2 |
| Activity: | acaricides (carbamate acaricides) insecticides (carbamate insecticides) plant growth regulators (growth inhibitors) |
| Notes: | The name “sevin” (цевин) was used in the former USSR, but Sevin is a registered trade mark in many countries. |
| Structure: |  |
| Pronunciation: | kar-ba-rīl Guide to British pronunciation |
| InChI: | InChI=1/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14)/f/h13H |