Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-chloro-4,5-dimethylphenyl methylcarbamate |
IUPAC name: | 2-chloro-4,5-dimethylphenyl methylcarbamate 1979 Rules: 6-chloro-3,4-xylyl methylcarbamate |
CAS name: | 2-chloro-4,5-dimethylphenyl N-methylcarbamate |
CAS Reg. No.: | 671-04-5 |
Formula: | C10H12ClNO2 |
Activity: | acaricides (phenyl carbamate) insecticides (phenyl carbamate) |
Notes: | |
Structure: | |
Pronunciation: | kar-bǎn-ǒl-āt Guide to British pronunciation |
InChIKey: | QRTXZGIQTYDABO-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H12ClNO2/c1-6-4-8(11)9(5-7(6)2)14-10(13)12-3/h4-5H,1-3H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names