| Status: | none |
|---|---|
| IUPAC: | mixture of copper sulfate and disodium carbonate |
| CAS: | disodium carbonate mixture with copper(2+) sulfate (1:1) |
| Reg. No.: | 11125-96-5 |
| Formula: | |
| Activity: | fungicides (copper fungicides) |
| Notes: | There is no ISO common name for this substance; the name “Burgundy mixture” has been used in the literature but has no official status. |
| Structure: |  |
| Pronunciation: | ber-gan-dē mǐkst-sha Guide to British pronunciation |
| InChI: | copper(2+) sulfate (1:1) InChI=1/Cu.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2/fCu.O4S/qm;-2 disodium carbonate InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m |