| Status: | none |
|---|---|
| IUPAC: | N-bromoacetamide |
| CAS: | N-bromoacetamide |
| Reg. No.: | 79-15-2 |
| Formula: | C2H4BrNO |
| Activity: | molluscicides |
| Notes: | There is no ISO common name for this substance; the name “bromoacetamide” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | brō-mō-a-sēt-a-mīd Guide to British pronunciation |
| InChI: | InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5)/f/h4H |
A data sheet from the Compendium of Pesticide Common Names