| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-5-bromo-3-sec-butyl-6-methyluracil |
| CAS: | 5-bromo-6-methyl-3-(1-methylpropyl)-2,4(1H,3H)-pyrimidinedione |
| Reg. No.: | 314-40-9 |
| Formula: | C9H13BrN2O2 |
| Activity: | herbicides (uracil herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example bromacil-lithium [53404-19-6], bromacil-sodium [69484-12-4]. |
| Structure: | ![]() |
| Pronunciation: | brō-ma-sǐl Guide to British pronunciation |
| InChIKey: | CTSLUCNDVMMDHG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H13BrN2O2/c1-4-5(2)12-8(13)7(10)6(3)11-9(12)14/h5H,4H2,1-3H3,(H,11,14) |
A data sheet from the Compendium of Pesticide Common Names