| Status: | none |
|---|---|
| IUPAC: | boric acid |
| CAS: | boric acid (H3BO3) |
| Reg. No.: | 10043-35-3 |
| Formula: | BH3O3 |
| Activity: | insecticides (desiccant insecticides; inorganic insecticides) |
| Notes: | There is no ISO common name for this substance; the name “boric acid” has been used in the literature but has no official status. |
| Structure: |  |
| Pronunciation: | bor-ǐk ǎs-ǐd Guide to British pronunciation |
| InChI: | InChI=1/BH3O3/c2-1(3)4/h2-4H |