Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 1,1′-biphenyl |
IUPAC name: | biphenyl |
CAS name: | 1,1′-biphenyl |
CAS Reg. No.: | 92-52-4 |
Formula: | C12H10 |
Activity: | fungicides (aromatic) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | bī-fēn-īl Guide to British pronunciation |
InChIKey: | ZUOUZKKEUPVFJK-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
A data sheet from the Compendium of Pesticide Common Names