| Status: | BS 1831c |
|---|---|
| IUPAC: | biphenyl |
| CAS: | 1,1′-biphenyl |
| Reg. No.: | 92-52-4 |
| Formula: | C12H10 |
| Activity: | fungicides (aromatic fungicides) |
| Notes: | This substance is considered by the British Standards Institution not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | bī-fēn-īl Guide to British pronunciation |
| InChIKey: | ZUOUZKKEUPVFJK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
A data sheet from the Compendium of Pesticide Common Names