| Status: | none |
|---|---|
| IUPAC: | N6-benzyladenine or N-benzyl-1H-purin-6-amine |
| CAS: | N-(phenylmethyl)-1H-purin-6-amine |
| Reg. No.: | 1214-39-7 |
| Formula: | C12H11N5 |
| Activity: | plant growth regulators (cytokinins) |
| Notes: | There is no ISO common name for this substance; the name “benzyladenine” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | běn-zīl-ǎd-ǐn-ēn Guide to British pronunciation |
| InChI: | InChI=1/C12H11N5/c1-2-4-9(5-3-1)6-13-11-10-12(15-7-14-10)17-8-16-11/h1-5,7-8H,6H2,(H2,13,14,15,16,17)/f/h13,16H |
A data sheet from the Compendium of Pesticide Common Names